CAS 89059-46-1 is the registry number for 2,3,7,8-Tetrachlorodibenzofuran-13C12. Offered by: TRC. Available pack sizes: 5mg.
2,3,7,8-tetrachlorodibenzofuran (CAS 89059-46-1) is a chemical compound with the molecular formula C12H4Cl4O and a molecular weight of 317.9 g/mol. IUPAC name: 2,3,7,8-tetrachlorodibenzofuran. InChIKey: KSMVNVHUTQZITP-WCGVKTIYSA-N.
| Molecular formula | C12H4Cl4O |
|---|---|
| Molecular weight | 317.9 g/mol |
| IUPAC name | 2,3,7,8-tetrachlorodibenzofuran |
| InChIKey | KSMVNVHUTQZITP-WCGVKTIYSA-N |
| SMILES | [13CH]1=[13C]2[13C]3=[13CH][13C](=[13C]([13CH]=[13C]3O[13C]2=[13CH][13C](=[13C]1Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)