Products 58859-66-8

CAS 58859-66-8 is the registry number for 3-[Benzyl-(2-ethoxycarbonyl-ethyl)-amino]-butyric acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

Ethyl 3-[benzyl-(3-ethoxy-3-oxopropyl)amino]butanoate (CAS 58859-66-8) is a chemical compound with the molecular formula C18H27NO4 and a molecular weight of 321.4 g/mol. IUPAC name: ethyl 3-[benzyl-(3-ethoxy-3-oxopropyl)amino]butanoate. InChIKey: IIGVDNNGQSLPPC-UHFFFAOYSA-N.

Identity
Molecular formulaC18H27NO4
Molecular weight321.4 g/mol
IUPAC nameethyl 3-[benzyl-(3-ethoxy-3-oxopropyl)amino]butanoate
InChIKeyIIGVDNNGQSLPPC-UHFFFAOYSA-N
SMILESCCOC(=O)CCN(CC1=CC=CC=C1)C(C)CC(=O)OCC

Computed by PubChem (NCBI)