CAS 98375-50-9 appears in our catalog under these names: Boc-dl-4-tert-butyl-phe, 95%, 2–((tert–Butoxycarbonyl)amino)–3–(4–(tert–butyl)phenyl)propanoic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
3-(4-tert-butylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 98375-50-9) is a chemical compound with the molecular formula C18H27NO4 and a molecular weight of 321.4 g/mol. IUPAC name: 3-(4-tert-butylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: NGWQIBYYDHXJJR-UHFFFAOYSA-N.
| Molecular formula | C18H27NO4 |
|---|---|
| Molecular weight | 321.4 g/mol |
| IUPAC name | 3-(4-tert-butylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | NGWQIBYYDHXJJR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)CC(C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)