Products 588720-42-7

CAS 588720-42-7 appears in our catalog under these names: Indolizine–6–carboxylic acid, Indolizine-6-carboxylic acid. Offered by: GLPBio, Biosynth. Available pack sizes: 100mg, 250mg, 2,5g.

Structural formula: {0} (CAS {1})

Indolizine-6-carboxylic acid (CAS 588720-42-7) is a chemical compound with the molecular formula C9H7NO2 and a molecular weight of 161.16 g/mol. IUPAC name: indolizine-6-carboxylic acid. InChIKey: JOVCSPPLSDQUOO-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7NO2
Molecular weight161.16 g/mol
IUPAC nameindolizine-6-carboxylic acid
InChIKeyJOVCSPPLSDQUOO-UHFFFAOYSA-N
SMILESC1=CN2C=C(C=CC2=C1)C(=O)O

Computed by PubChem (NCBI)