CAS 588720-42-7 appears in our catalog under these names: Indolizine–6–carboxylic acid, Indolizine-6-carboxylic acid. Offered by: GLPBio, Biosynth. Available pack sizes: 100mg, 250mg, 2,5g.
Indolizine-6-carboxylic acid (CAS 588720-42-7) is a chemical compound with the molecular formula C9H7NO2 and a molecular weight of 161.16 g/mol. IUPAC name: indolizine-6-carboxylic acid. InChIKey: JOVCSPPLSDQUOO-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2 |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | indolizine-6-carboxylic acid |
| InChIKey | JOVCSPPLSDQUOO-UHFFFAOYSA-N |
| SMILES | C1=CN2C=C(C=CC2=C1)C(=O)O |
Computed by PubChem (NCBI)