Products 58883-98-0

CAS 58883-98-0 is the registry number for 3-Phenoxypropyl acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

3-phenoxypropyl acetate (CAS 58883-98-0) is a chemical compound with the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. IUPAC name: 3-phenoxypropyl acetate. InChIKey: FZOXUFODEISZLN-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14O3
Molecular weight194.23 g/mol
IUPAC name3-phenoxypropyl acetate
InChIKeyFZOXUFODEISZLN-UHFFFAOYSA-N
SMILESCC(=O)OCCCOC1=CC=CC=C1

Computed by PubChem (NCBI)