Products 58911-49-2
CAS 58911-49-2 appears in our catalog under these names: (4S,5R,E)-4,5-dihydroxyhex-2-enoic acid, rel-(2E,4R,5S)-4,5-Dihydroxy-2-Hexenoic Acid. Offered by: Chemat Brand. Available pack sizes: on request.
(E,4S,5R)-4,5-dihydroxyhex-2-enoic acid (CAS 58911-49-2) is a chemical compound with the molecular formula C6H10O4 and a molecular weight of 146.14 g/mol. IUPAC name: (E,4S,5R)-4,5-dihydroxyhex-2-enoic acid. InChIKey: MHJHGMSWCVGANA-ZRUBAPSRSA-N.
| Molecular formula | C6H10O4 |
|---|---|
| Molecular weight | 146.14 g/mol |
| IUPAC name | (E,4S,5R)-4,5-dihydroxyhex-2-enoic acid |
| InChIKey | MHJHGMSWCVGANA-ZRUBAPSRSA-N |
| SMILES | C[C@H]([C@H](/C=C/C(=O)O)O)O |
Computed by PubChem (NCBI)