CAS 58918-19-7 is the registry number for Dezocine Impurity 8. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,9R,15S)-15-amino-1-methyltricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trien-4-ol (CAS 58918-19-7) is a chemical compound with the molecular formula C16H23NO and a molecular weight of 245.36 g/mol. IUPAC name: (1S,9R,15S)-15-amino-1-methyltricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trien-4-ol. InChIKey: VTMVHDZWSFQSQP-KCXAZCMYSA-N.
| Molecular formula | C16H23NO |
|---|---|
| Molecular weight | 245.36 g/mol |
| IUPAC name | (1S,9R,15S)-15-amino-1-methyltricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trien-4-ol |
| InChIKey | VTMVHDZWSFQSQP-KCXAZCMYSA-N |
| SMILES | C[C@@]12CCCCC[C@@H]([C@@H]1N)CC3=C2C=C(C=C3)O |
Computed by PubChem (NCBI)