CAS 1346600-38-1 appears in our catalog under these names: Phenol, 4-[1-(1-cyclohexen-1-yl)-2-(dimethylamino)ethyl]-, 95%, 95%, Venlafaxine Impurity 6, Venlafaxine Anhydro O-Desmethyl Impurity, Desvenlafaxine Anhydro Impurity, rac Dehydro-O-desmethyl Venlafaxine, >95% (HPLC), rac Dehydro-o-desmethyl venlafaxine. Offered by: Chemat, Chemat Brand, TRC, Biosynth. Available pack sizes: 1g, 100mg, 250mg, on request, 10mg, 1mg, 25mg.
4-[1-(cyclohexen-1-yl)-2-(dimethylamino)ethyl]phenol (CAS 1346600-38-1) is a chemical compound with the molecular formula C16H23NO and a molecular weight of 245.36 g/mol. IUPAC name: 4-[1-(cyclohexen-1-yl)-2-(dimethylamino)ethyl]phenol. InChIKey: TZCZNCWNSMBGJC-UHFFFAOYSA-N.
| Molecular formula | C16H23NO |
|---|---|
| Molecular weight | 245.36 g/mol |
| IUPAC name | 4-[1-(cyclohexen-1-yl)-2-(dimethylamino)ethyl]phenol |
| InChIKey | TZCZNCWNSMBGJC-UHFFFAOYSA-N |
| SMILES | CN(C)CC(C1=CCCCC1)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)