CAS 2883422-05-5 is the registry number for 2-(tert-Butyl)-4-(5-methyl-1,4,5,6-tetrahydropyridin-2-yl)phenol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-tert-butyl-4-(3-methyl-1,2,3,4-tetrahydropyridin-6-yl)phenol (CAS 2883422-05-5) is a chemical compound with the molecular formula C16H23NO and a molecular weight of 245.36 g/mol. IUPAC name: 2-tert-butyl-4-(3-methyl-1,2,3,4-tetrahydropyridin-6-yl)phenol. InChIKey: ZRINPONUPJNUEP-UHFFFAOYSA-N.
| Molecular formula | C16H23NO |
|---|---|
| Molecular weight | 245.36 g/mol |
| IUPAC name | 2-tert-butyl-4-(3-methyl-1,2,3,4-tetrahydropyridin-6-yl)phenol |
| InChIKey | ZRINPONUPJNUEP-UHFFFAOYSA-N |
| SMILES | CC1CC=C(NC1)C2=CC(=C(C=C2)O)C(C)(C)C |
Computed by PubChem (NCBI)