CAS 5892-99-9 appears in our catalog under these names: N,N-Diethyl-4-bromobenzamide, 4-Bromo-N,N-diethylbenzamide 95%, N,N-Diethyl 4-bromobenzamide, 95%, 95%, 4-Bromo-N,N-diethylbenzamide, 95%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 0,25g, 2,5g, 1g, 5g, 25g.
4-bromo-N,N-diethylbenzamide (CAS 5892-99-9) is a chemical compound with the molecular formula C11H14BrNO and a molecular weight of 256.14 g/mol. IUPAC name: 4-bromo-N,N-diethylbenzamide. InChIKey: LDUPVXSXLZOQAF-UHFFFAOYSA-N.
| Molecular formula | C11H14BrNO |
|---|---|
| Molecular weight | 256.14 g/mol |
| IUPAC name | 4-bromo-N,N-diethylbenzamide |
| InChIKey | LDUPVXSXLZOQAF-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)