Products 58952-47-9
CAS 58952-47-9 appears in our catalog under these names: N-Hydroxy-1-(phenylsulfonyl)methanimidoyl cyanide sodium, 98%, N-Hydroxy-1-(phenylsulfonyl)methanimidoyl cyanide (sodium), 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Sodium (1E)-1-(benzenesulfonyl)-N-oxidomethanimidoyl cyanide (CAS 58952-47-9) is a chemical compound with the molecular formula C8H5N2NaO3S and a molecular weight of 232.19 g/mol. IUPAC name: sodium (1E)-1-(benzenesulfonyl)-N-oxidomethanimidoyl cyanide. InChIKey: SMOISLTXBOYHHI-VRTOBVRTSA-M.
| Molecular formula | C8H5N2NaO3S |
|---|---|
| Molecular weight | 232.19 g/mol |
| IUPAC name | sodium (1E)-1-(benzenesulfonyl)-N-oxidomethanimidoyl cyanide |
| InChIKey | SMOISLTXBOYHHI-VRTOBVRTSA-M |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)/C(=N/[O-])/C#N.[Na+] |
Computed by PubChem (NCBI)