Products 59043-22-0
CAS 59043-22-0 appears in our catalog under these names: 8a-Amino-6-methylergoline, 8Alpha-Amino-6-methylergoline. Offered by: TRC. Available pack sizes: 10mg, 1mg, 5mg.
(6aR,9S,10aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-amine (CAS 59043-22-0) is a chemical compound with the molecular formula C15H19N3 and a molecular weight of 241.33 g/mol. IUPAC name: (6aR,9S,10aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-amine. InChIKey: KGUBZNRUCSWDAU-ZKYQVNSYSA-N.
| Molecular formula | C15H19N3 |
|---|---|
| Molecular weight | 241.33 g/mol |
| IUPAC name | (6aR,9S,10aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-amine |
| InChIKey | KGUBZNRUCSWDAU-ZKYQVNSYSA-N |
| SMILES | CN1C[C@H](C[C@H]2[C@H]1CC3=CNC4=CC=CC2=C34)N |
Computed by PubChem (NCBI)