CAS 59229-60-6 is the registry number for Amorolfine Impurity 13 HCl. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,6S)-2,6-dimethylmorpholine;hydrochloride (CAS 59229-60-6) is a chemical compound with the molecular formula C6H14ClNO and a molecular weight of 151.63 g/mol. IUPAC name: (2R,6S)-2,6-dimethylmorpholine;hydrochloride. InChIKey: SFEUYYPUMLXCLF-KNCHESJLSA-N.
| Molecular formula | C6H14ClNO |
|---|---|
| Molecular weight | 151.63 g/mol |
| IUPAC name | (2R,6S)-2,6-dimethylmorpholine;hydrochloride |
| InChIKey | SFEUYYPUMLXCLF-KNCHESJLSA-N |
| SMILES | C[C@@H]1CNC[C@@H](O1)C.Cl |
Computed by PubChem (NCBI)