CAS 59341-68-3 appears in our catalog under these names: 6–Methyl–2–(pyridin–4–yl)pyrimidin–4(3H)–one, 6-Methyl-2-(pyridin-4-yl)pyrimidin-4(3H)-one, 95%. Offered by: GLPBio, Fluorochem. Available pack sizes: 100mg, 1g.
4-methyl-2-pyridin-4-yl-1H-pyrimidin-6-one (CAS 59341-68-3) is a chemical compound with the molecular formula C10H9N3O and a molecular weight of 187.20 g/mol. IUPAC name: 4-methyl-2-pyridin-4-yl-1H-pyrimidin-6-one. InChIKey: UFMQZZRBKSOEKS-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O |
|---|---|
| Molecular weight | 187.20 g/mol |
| IUPAC name | 4-methyl-2-pyridin-4-yl-1H-pyrimidin-6-one |
| InChIKey | UFMQZZRBKSOEKS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)NC(=N1)C2=CC=NC=C2 |
Computed by PubChem (NCBI)