Products 59394-30-8
CAS 59394-30-8 appears in our catalog under these names: 6-Chloroquinoline-2-carboxylic acid, 97%, 6–Chloroquinoline–2–carboxylic acid, 6-chloroquinoline-2-carboxylic acid, 6-Chloroquinoline-2-carboxylic acid 95%, 6-Chloroquinoline-2-carboxylic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg, 0,5g.
6-chloroquinoline-2-carboxylic acid (CAS 59394-30-8) is a chemical compound with the molecular formula C10H6ClNO2 and a molecular weight of 207.61 g/mol. IUPAC name: 6-chloroquinoline-2-carboxylic acid. InChIKey: UKMWQYNJAVNCOZ-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO2 |
|---|---|
| Molecular weight | 207.61 g/mol |
| IUPAC name | 6-chloroquinoline-2-carboxylic acid |
| InChIKey | UKMWQYNJAVNCOZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=N2)C(=O)O)C=C1Cl |
Computed by PubChem (NCBI)
Synonyms:
UKMWQYNJAVNCOZ-UHFFFAOYSA-N