CAS 59468-42-7 appears in our catalog under these names: Midazolam Methyl Ester, 8-Chloro-6-(2-fluorophenyl)-1-methyl-4H-imidazo(1,5-a)(1,4)benzodiazepine-3-carboxylic Acid Methyl Ester. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 2,5mg, 25mg, 5mg, 50mg.
Methyl 8-chloro-6-(2-fluorophenyl)-1-methyl-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate (CAS 59468-42-7) is a chemical compound with the molecular formula C20H15ClFN3O2 and a molecular weight of 383.8 g/mol. IUPAC name: methyl 8-chloro-6-(2-fluorophenyl)-1-methyl-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate. InChIKey: AUHFGWRAZMECLY-UHFFFAOYSA-N.
| Molecular formula | C20H15ClFN3O2 |
|---|---|
| Molecular weight | 383.8 g/mol |
| IUPAC name | methyl 8-chloro-6-(2-fluorophenyl)-1-methyl-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate |
| InChIKey | AUHFGWRAZMECLY-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C2N1C3=C(C=C(C=C3)Cl)C(=NC2)C4=CC=CC=C4F)C(=O)OC |
Computed by PubChem (NCBI)