CAS 59468-84-7 is the registry number for 4-Acetoxy Midazolam. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 2mg, 5mg, 1mg.
[8-chloro-6-(2-fluorophenyl)-1-methyl-4H-imidazo[1,5-a][1,4]benzodiazepin-4-yl] acetate (CAS 59468-84-7) is a chemical compound with the molecular formula C20H15ClFN3O2 and a molecular weight of 383.8 g/mol. IUPAC name: [8-chloro-6-(2-fluorophenyl)-1-methyl-4H-imidazo[1,5-a][1,4]benzodiazepin-4-yl] acetate. InChIKey: ZJOYIVDHZXTWKB-UHFFFAOYSA-N.
| Molecular formula | C20H15ClFN3O2 |
|---|---|
| Molecular weight | 383.8 g/mol |
| IUPAC name | [8-chloro-6-(2-fluorophenyl)-1-methyl-4H-imidazo[1,5-a][1,4]benzodiazepin-4-yl] acetate |
| InChIKey | ZJOYIVDHZXTWKB-UHFFFAOYSA-N |
| SMILES | CC1=NC=C2N1C3=C(C=C(C=C3)Cl)C(=NC2OC(=O)C)C4=CC=CC=C4F |
Computed by PubChem (NCBI)