Products 594823-51-5

CAS 594823-51-5 appears in our catalog under these names: Butamirate Impurity 8, 1,2,3,6-Tetrahydro-2-oxo-5,6-diphenyl-4-pyrimidinecarboxylic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.

Structural formula: {0} (CAS {1})

2-oxo-4,5-diphenyl-3,4-dihydro-1H-pyrimidine-6-carboxylic acid (CAS 594823-51-5) is a chemical compound with the molecular formula C17H14N2O3 and a molecular weight of 294.30 g/mol. IUPAC name: 2-oxo-4,5-diphenyl-3,4-dihydro-1H-pyrimidine-6-carboxylic acid. InChIKey: ABCLRPZXCWAQQQ-UHFFFAOYSA-N.

Identity
Molecular formulaC17H14N2O3
Molecular weight294.30 g/mol
IUPAC name2-oxo-4,5-diphenyl-3,4-dihydro-1H-pyrimidine-6-carboxylic acid
InChIKeyABCLRPZXCWAQQQ-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2C(=C(NC(=O)N2)C(=O)O)C3=CC=CC=C3

Computed by PubChem (NCBI)