CAS 59605-49-1 is the registry number for AA 497 (Free Base). Offered by: TargetMol, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, Get quote.
(1S,2S)-5-(hydroxymethyl)-2-(propan-2-ylamino)-1,2,3,4-tetrahydronaphthalene-1,6-diol (CAS 59605-49-1) is a chemical compound with the molecular formula C14H21NO3 and a molecular weight of 251.32 g/mol. IUPAC name: (1S,2S)-5-(hydroxymethyl)-2-(propan-2-ylamino)-1,2,3,4-tetrahydronaphthalene-1,6-diol. InChIKey: BRGJIYTULBITAY-JSGCOSHPSA-N.
| Molecular formula | C14H21NO3 |
|---|---|
| Molecular weight | 251.32 g/mol |
| IUPAC name | (1S,2S)-5-(hydroxymethyl)-2-(propan-2-ylamino)-1,2,3,4-tetrahydronaphthalene-1,6-diol |
| InChIKey | BRGJIYTULBITAY-JSGCOSHPSA-N |
| SMILES | CC(C)N[C@H]1CCC2=C([C@@H]1O)C=CC(=C2CO)O |
Computed by PubChem (NCBI)