Products 59652-74-3
CAS 59652-74-3 appears in our catalog under these names: (S)-(-)-Malic-2,3,3-d3 Acid, 98 atom % D, min 98% Chemical Purity, (S)–Malic acid–d3, (S)-Malic acid-d3, 99.05%. Offered by: CDN, GLPBio, MedChemExpress. Available pack sizes: 0,01g, 0,005g, 5mg, 10 mg, 5 mg, 1 mg.
(3S)-2,2,3-trideuterio-3-hydroxybutanedioic acid (CAS 59652-74-3) is a chemical compound with the molecular formula C4H6O5 and a molecular weight of 137.11 g/mol. IUPAC name: (3S)-2,2,3-trideuterio-3-hydroxybutanedioic acid. InChIKey: BJEPYKJPYRNKOW-RBXBQAPRSA-N.
| Molecular formula | C4H6O5 |
|---|---|
| Molecular weight | 137.11 g/mol |
| IUPAC name | (3S)-2,2,3-trideuterio-3-hydroxybutanedioic acid |
| InChIKey | BJEPYKJPYRNKOW-RBXBQAPRSA-N |
| SMILES | [2H][C@@](C(=O)O)(C([2H])([2H])C(=O)O)O |
Computed by PubChem (NCBI)