Products 97230-97-2

CAS 97230-97-2 is the registry number for 2,2-Dihydroxy-3-oxobutanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2,2-dihydroxy-3-oxobutanoic acid (CAS 97230-97-2) is a chemical compound with the molecular formula C4H6O5 and a molecular weight of 134.09 g/mol. IUPAC name: 2,2-dihydroxy-3-oxobutanoic acid. InChIKey: HVDFUVLFCQSGAK-UHFFFAOYSA-N.

Identity
Molecular formulaC4H6O5
Molecular weight134.09 g/mol
IUPAC name2,2-dihydroxy-3-oxobutanoic acid
InChIKeyHVDFUVLFCQSGAK-UHFFFAOYSA-N
SMILESCC(=O)C(C(=O)O)(O)O

Computed by PubChem (NCBI)