CAS 596819-10-2 appears in our catalog under these names: 1-Methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole, 98%, 1-Methylindole-2-boronic acid, pinacol ester, 98%, 1-Methyl-2-indoleboronic acid pinacol ester, 95-<97%, 1-Methyl-2-indoleboronic acid pinacol ester, ≥97-<99%, 1-Methylindole-2-boronic acid, pinacol ester, 98%, 98%. Offered by: Fluorochem, Ambeed, Combi-blocks, Hoffman Fine Chemicals, Chemat. Available pack sizes: 1g, 5g, 250mg, 10g, 25g, 50g, 100g, 200g.
1-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole (CAS 596819-10-2) is a chemical compound with the molecular formula C15H20BNO2 and a molecular weight of 257.14 g/mol. IUPAC name: 1-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole. InChIKey: KMLZZUZKSQWHKC-UHFFFAOYSA-N.
| Molecular formula | C15H20BNO2 |
|---|---|
| Molecular weight | 257.14 g/mol |
| IUPAC name | 1-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
| InChIKey | KMLZZUZKSQWHKC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=CC=CC=C3N2C |
Computed by PubChem (NCBI)