Products 59691-15-5
CAS 59691-15-5 appears in our catalog under these names: Proparacaine Impurity 5, 3-amino-4-propoxy-Benzoic acid, >95% (HPLC), 3-Amino-4-propoxybenzoic acid, 3-Amino-4-propoxybenzoic acid 95%, 3-Amino-4-propoxybenzoic acid, 95%, 95%. Offered by: Chemat Brand, TRC, Biosynth, Ambeed, Chemat. Available pack sizes: on request, 250mg, 50mg, 1g, 100mg.
3-amino-4-propoxybenzoic acid (CAS 59691-15-5) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: 3-amino-4-propoxybenzoic acid. InChIKey: UZOZIVWRRZWJMT-UHFFFAOYSA-N.
| Molecular formula | C10H13NO3 |
|---|---|
| Molecular weight | 195.21 g/mol |
| IUPAC name | 3-amino-4-propoxybenzoic acid |
| InChIKey | UZOZIVWRRZWJMT-UHFFFAOYSA-N |
| SMILES | CCCOC1=C(C=C(C=C1)C(=O)O)N |
Computed by PubChem (NCBI)