Products 59694-51-8
CAS 59694-51-8 appears in our catalog under these names: Ethyl 7-amino-5-chloro-1H-indole-2-carboxylate, 97%, 1H-Indole-2-carboxylic acid, 7-amino-5-chloro-, ethyl ester, 97%. Offered by: Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg.
Ethyl 7-amino-5-chloro-1H-indole-2-carboxylate (CAS 59694-51-8) is a chemical compound with the molecular formula C11H11ClN2O2 and a molecular weight of 238.67 g/mol. IUPAC name: ethyl 7-amino-5-chloro-1H-indole-2-carboxylate. InChIKey: PIHIUNXBMGLYRF-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2O2 |
|---|---|
| Molecular weight | 238.67 g/mol |
| IUPAC name | ethyl 7-amino-5-chloro-1H-indole-2-carboxylate |
| InChIKey | PIHIUNXBMGLYRF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=CC(=CC(=C2N1)N)Cl |
Computed by PubChem (NCBI)