CAS 59715-45-6 appears in our catalog under these names: 5,6-Dichloropyrazine-2,3-dicarboxylic acid, 97%, 5,6–Dichloropyrazine–2,3–dicarboxylic acid, 5,6-Dichloropyrazine-2,3-dicarboxylic acid, 97%, 97%. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
5,6-dichloropyrazine-2,3-dicarboxylic acid (CAS 59715-45-6) is a chemical compound with the molecular formula C6H2Cl2N2O4 and a molecular weight of 236.99 g/mol. IUPAC name: 5,6-dichloropyrazine-2,3-dicarboxylic acid. InChIKey: WPBFEEVLBDWFGP-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2N2O4 |
|---|---|
| Molecular weight | 236.99 g/mol |
| IUPAC name | 5,6-dichloropyrazine-2,3-dicarboxylic acid |
| InChIKey | WPBFEEVLBDWFGP-UHFFFAOYSA-N |
| SMILES | C1(=C(N=C(C(=N1)Cl)Cl)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)