CAS 597545-05-6 is the registry number for 4-Bromo-5-[(4-methylphenyl)thio]-2-furaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-bromo-5-(4-methylphenyl)sulfanylfuran-2-carbaldehyde (CAS 597545-05-6) is a chemical compound with the molecular formula C12H9BrO2S and a molecular weight of 297.17 g/mol. IUPAC name: 4-bromo-5-(4-methylphenyl)sulfanylfuran-2-carbaldehyde. InChIKey: DISPPBMPQGHDDM-UHFFFAOYSA-N.
| Molecular formula | C12H9BrO2S |
|---|---|
| Molecular weight | 297.17 g/mol |
| IUPAC name | 4-bromo-5-(4-methylphenyl)sulfanylfuran-2-carbaldehyde |
| InChIKey | DISPPBMPQGHDDM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)SC2=C(C=C(O2)C=O)Br |
Computed by PubChem (NCBI)