CAS 649569-57-3 is the registry number for Methyl 5-(4-bromophenyl)thiophene-2-carboxylate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
Methyl 5-(4-bromophenyl)thiophene-2-carboxylate (CAS 649569-57-3) is a chemical compound with the molecular formula C12H9BrO2S and a molecular weight of 297.17 g/mol. IUPAC name: methyl 5-(4-bromophenyl)thiophene-2-carboxylate. InChIKey: GARRRQOUTNGJPB-UHFFFAOYSA-N.
| Molecular formula | C12H9BrO2S |
|---|---|
| Molecular weight | 297.17 g/mol |
| IUPAC name | methyl 5-(4-bromophenyl)thiophene-2-carboxylate |
| InChIKey | GARRRQOUTNGJPB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(S1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)