CAS 59847-86-8 appears in our catalog under these names: 1-Benzofuran-2-carboximidamide hydrochloride, 95%, 1-Benzofuran-2-carboximidamide hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 2,5g, 250mg.
1-benzofuran-2-carboximidamide;hydrochloride (CAS 59847-86-8) is a chemical compound with the molecular formula C9H9ClN2O and a molecular weight of 196.63 g/mol. IUPAC name: 1-benzofuran-2-carboximidamide;hydrochloride. InChIKey: DTRNSGDRJUUYDP-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2O |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | 1-benzofuran-2-carboximidamide;hydrochloride |
| InChIKey | DTRNSGDRJUUYDP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(O2)C(=N)N.Cl |
Computed by PubChem (NCBI)