CAS 59899-56-8 is the registry number for 3-(1,2-Benzoxazol-3-yl)propanenitrile. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(1,2-benzoxazol-3-yl)propanenitrile (CAS 59899-56-8) is a chemical compound with the molecular formula C10H8N2O and a molecular weight of 172.18 g/mol. IUPAC name: 3-(1,2-benzoxazol-3-yl)propanenitrile. InChIKey: UVECZJOMLAWTEK-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | 3-(1,2-benzoxazol-3-yl)propanenitrile |
| InChIKey | UVECZJOMLAWTEK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NO2)CCC#N |
Computed by PubChem (NCBI)