CAS 59906-15-9 is the registry number for (3a,5a,7a,12a,23S)-Cholestane-3,7,12,23,25-pentol, >95% (HPLC). Offered by: TRC. Available pack sizes: 0,5mg.
5b-cholestane-3a,7a,12a,23S,25-pentol is a 3alpha-hydroxy steroid, a 7alpha-hydroxy steroid, a 12-hydroxy steroid, a 25-hydroxy steroid and a 23-hydroxy steroid. It derives from a hydride of a 5beta-cholestane.
Source: ChEBI
| Molecular formula | C27H48O5 |
|---|---|
| Molecular weight | 452.7 g/mol |
| IUPAC name | (3R,5S,7R,8R,9S,10S,12S,13R,14S,17R)-17-[(2R,4S)-4,6-dihydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,7,12-triol |
| InChIKey | OXSBBBPDYVCAKC-WGFUQMKWSA-N |
| SMILES | C[C@H](C[C@@H](CC(C)(C)O)O)[C@H]1CC[C@@H]2[C@@]1([C@H](C[C@H]3[C@H]2[C@@H](C[C@H]4[C@@]3(CC[C@H](C4)O)C)O)O)C |
Computed by PubChem (NCBI)