CAS 6127-75-9 is the registry number for 5beta-Cholestane-3alpha,7alpha,12alpha,25,27-pentol. Offered by: TRC. Available pack sizes: 10mg.
5beta-bufol is the 5beta-stereoisomer of bufol. It has a role as an animal metabolite and a human urinary metabolite.
Source: ChEBI
| Molecular formula | C27H48O5 |
|---|---|
| Molecular weight | 452.7 g/mol |
| IUPAC name | (3R,5S,7R,8R,9S,10S,12S,13R,14S,17R)-17-[(2R)-6,7-dihydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,7,12-triol |
| InChIKey | XZDHXPDYLPEFQI-FIMPYCPFSA-N |
| SMILES | C[C@H](CCCC(C)(CO)O)[C@H]1CC[C@@H]2[C@@]1([C@H](C[C@H]3[C@H]2[C@@H](C[C@H]4[C@@]3(CC[C@H](C4)O)C)O)O)C |
Computed by PubChem (NCBI)