CAS 59940-35-1 appears in our catalog under these names: Memantine Impurity 42, 1,3-Bis(acetylamino)adamantane. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1g.
N-(3-acetamido-1-adamantyl)acetamide (CAS 59940-35-1) is a chemical compound with the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. IUPAC name: N-(3-acetamido-1-adamantyl)acetamide. InChIKey: IDKMCHZWZPAIGE-UHFFFAOYSA-N.
| Molecular formula | C14H22N2O2 |
|---|---|
| Molecular weight | 250.34 g/mol |
| IUPAC name | N-(3-acetamido-1-adamantyl)acetamide |
| InChIKey | IDKMCHZWZPAIGE-UHFFFAOYSA-N |
| SMILES | CC(=O)NC12CC3CC(C1)CC(C3)(C2)NC(=O)C |
Computed by PubChem (NCBI)