CAS 59962-54-8 appears in our catalog under these names: N-Desmethyl-N-hydroxymethyl Tebuthiuron, >95% (HPLC), Tebuthiuron-N-hydroxymethyl. Offered by: TRC, Dr. Ehrenstorfer, Biosynth. Available pack sizes: 25mg, 50mg, 5mg, 10mg, 100mg.
1-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-3-(hydroxymethyl)-1-methylurea (CAS 59962-54-8) is a chemical compound with the molecular formula C9H16N4O2S and a molecular weight of 244.32 g/mol. IUPAC name: 1-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-3-(hydroxymethyl)-1-methylurea. InChIKey: YDWOTDZRDFOARW-UHFFFAOYSA-N.
| Molecular formula | C9H16N4O2S |
|---|---|
| Molecular weight | 244.32 g/mol |
| IUPAC name | 1-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-3-(hydroxymethyl)-1-methylurea |
| InChIKey | YDWOTDZRDFOARW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NN=C(S1)N(C)C(=O)NCO |
Computed by PubChem (NCBI)