CAS 65411-36-1 is the registry number for 2-Desmethyl-2-hydroxymethyl Tebuthiuron. Offered by: TRC. Available pack sizes: 100mg.
1-[5-(1-hydroxy-2-methylpropan-2-yl)-1,3,4-thiadiazol-2-yl]-1,3-dimethylurea (CAS 65411-36-1) is a chemical compound with the molecular formula C9H16N4O2S and a molecular weight of 244.32 g/mol. IUPAC name: 1-[5-(1-hydroxy-2-methylpropan-2-yl)-1,3,4-thiadiazol-2-yl]-1,3-dimethylurea. InChIKey: YIBFNHISAHDKAS-UHFFFAOYSA-N.
| Molecular formula | C9H16N4O2S |
|---|---|
| Molecular weight | 244.32 g/mol |
| IUPAC name | 1-[5-(1-hydroxy-2-methylpropan-2-yl)-1,3,4-thiadiazol-2-yl]-1,3-dimethylurea |
| InChIKey | YIBFNHISAHDKAS-UHFFFAOYSA-N |
| SMILES | CC(C)(CO)C1=NN=C(S1)N(C)C(=O)NC |
Computed by PubChem (NCBI)