Products 60178-98-5

CAS 60178-98-5 is the registry number for ethyl 5-hydroxy-4-methyl-1H-pyrazole-3-carboxylate. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 4-methyl-5-oxo-1,2-dihydropyrazole-3-carboxylate (CAS 60178-98-5) is a chemical compound with the molecular formula C7H10N2O3 and a molecular weight of 170.17 g/mol. IUPAC name: ethyl 4-methyl-5-oxo-1,2-dihydropyrazole-3-carboxylate. InChIKey: UZYUEVONCXSOKT-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10N2O3
Molecular weight170.17 g/mol
IUPAC nameethyl 4-methyl-5-oxo-1,2-dihydropyrazole-3-carboxylate
InChIKeyUZYUEVONCXSOKT-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(C(=O)NN1)C

Computed by PubChem (NCBI)