CAS 602-37-9 appears in our catalog under these names: 1-Chloro-8-nitronaphthalene, 95%, 1-Chloro-8-nitronaphthalene, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
1-chloro-8-nitronaphthalene (CAS 602-37-9) is a chemical compound with the molecular formula C10H6ClNO2 and a molecular weight of 207.61 g/mol. IUPAC name: 1-chloro-8-nitronaphthalene. InChIKey: QOHQXCPALCHOID-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO2 |
|---|---|
| Molecular weight | 207.61 g/mol |
| IUPAC name | 1-chloro-8-nitronaphthalene |
| InChIKey | QOHQXCPALCHOID-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)[N+](=O)[O-])C(=CC=C2)Cl |
Computed by PubChem (NCBI)