CAS 60287-68-5 appears in our catalog under these names: 3-Methyl-2-phenoxyaniline, 95%, 3-Methyl-2-phenoxyaniline, 95+%, 3–Methyl–2–phenoxyaniline. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 10g, 250mg, 1g, 5g, 100mg.
3-methyl-2-phenoxyaniline (CAS 60287-68-5) is a chemical compound with the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. IUPAC name: 3-methyl-2-phenoxyaniline. InChIKey: XKHJBOMKTIVLMP-UHFFFAOYSA-N.
| Molecular formula | C13H13NO |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | 3-methyl-2-phenoxyaniline |
| InChIKey | XKHJBOMKTIVLMP-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)N)OC2=CC=CC=C2 |
Computed by PubChem (NCBI)