CAS 603-11-2 appears in our catalog under these names: Pomalidomide Impurity 2, 3-Nitrophthalic Acid, >95% (HPLC), 3-Nitrophthalic Acid, 3–Nitrophthalic acid, 3-Nitrophthalic acid/ 98+%. Offered by: Chemat Brand, TRC, Mikromol, GLPBio, Chemat. Available pack sizes: on request, 10g, 250g, 25mg, 500g, 50g, 100g, 25g.
3-nitrophthalic acid (CAS 603-11-2) is a chemical compound with the molecular formula C8H5NO6 and a molecular weight of 211.13 g/mol. IUPAC name: 3-nitrophthalic acid. InChIKey: KFIRODWJCYBBHY-UHFFFAOYSA-N.
| Molecular formula | C8H5NO6 |
|---|---|
| Molecular weight | 211.13 g/mol |
| IUPAC name | 3-nitrophthalic acid |
| InChIKey | KFIRODWJCYBBHY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])C(=O)O)C(=O)O |
Computed by PubChem (NCBI)