CAS 603-83-8 appears in our catalog under these names: 2-Methyl-3-nitroaniline, 95%, 2-Amino-6-nitrotoluene, 2–Methyl–3–nitroaniline, 2-Methyl-3-nitroaniline, >98.0%(GC), 2-Methyl-3-nitroaniline. Offered by: Combi-blocks, Dr. Ehrenstorfer, GLPBio, TCI, Biosynth. Available pack sizes: 25g, 5g, 100g, 1g, 250mg, 250g, 50g, 25000g.
2-methyl-3-nitroaniline (CAS 603-83-8) is a chemical compound with the molecular formula C7H8N2O2 and a molecular weight of 152.15 g/mol. IUPAC name: 2-methyl-3-nitroaniline. InChIKey: HFCFJYRLBAANKN-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O2 |
|---|---|
| Molecular weight | 152.15 g/mol |
| IUPAC name | 2-methyl-3-nitroaniline |
| InChIKey | HFCFJYRLBAANKN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1[N+](=O)[O-])N |
Computed by PubChem (NCBI)