CAS 60319-07-5 is the registry number for 2,6-Dimethoxyphenyl trifluoromethanesulfonate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g.
(2,6-dimethoxyphenyl) trifluoromethanesulfonate (CAS 60319-07-5) is a chemical compound with the molecular formula C9H9F3O5S and a molecular weight of 286.23 g/mol. IUPAC name: (2,6-dimethoxyphenyl) trifluoromethanesulfonate. InChIKey: MMOZMBDXJRPZLZ-UHFFFAOYSA-N.
| Molecular formula | C9H9F3O5S |
|---|---|
| Molecular weight | 286.23 g/mol |
| IUPAC name | (2,6-dimethoxyphenyl) trifluoromethanesulfonate |
| InChIKey | MMOZMBDXJRPZLZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC=C1)OC)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)