CAS 60319-09-7 appears in our catalog under these names: 3,5-Dimethoxyphenyl trifluoromethanesulfonate, 95%, 3,5-Dimethoxyphenyl triflate 95+%, 3,5-DIMETHOXYPHENYL TRIFLUOROMETHANESUL&, 3,5-Dimethoxyphenyl triflate, 97%, 97%, 3,5-Dimethoxyphenyl triflate, 97%. Offered by: Combi-blocks, Ambeed, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 100g.
(3,5-dimethoxyphenyl) trifluoromethanesulfonate (CAS 60319-09-7) is a chemical compound with the molecular formula C9H9F3O5S and a molecular weight of 286.23 g/mol. IUPAC name: (3,5-dimethoxyphenyl) trifluoromethanesulfonate. InChIKey: XCOBIQQRDHVTAN-UHFFFAOYSA-N.
| Molecular formula | C9H9F3O5S |
|---|---|
| Molecular weight | 286.23 g/mol |
| IUPAC name | (3,5-dimethoxyphenyl) trifluoromethanesulfonate |
| InChIKey | XCOBIQQRDHVTAN-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)OS(=O)(=O)C(F)(F)F)OC |
Computed by PubChem (NCBI)