CAS 60388-36-5 appears in our catalog under these names: 4-(Trifluoromethyl)-1,3-benzothiazol-2-amine, 95%, 4-(Trifluoromethyl)-1,3-benzothiazol-2-amine. Offered by: Combi-blocks, TRC. Available pack sizes: 1g, 250mg.
4-(trifluoromethyl)-1,3-benzothiazol-2-amine (CAS 60388-36-5) is a chemical compound with the molecular formula C8H5F3N2S and a molecular weight of 218.20 g/mol. IUPAC name: 4-(trifluoromethyl)-1,3-benzothiazol-2-amine. InChIKey: FGZBTCDIPNGYRC-UHFFFAOYSA-N.
| Molecular formula | C8H5F3N2S |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | 4-(trifluoromethyl)-1,3-benzothiazol-2-amine |
| InChIKey | FGZBTCDIPNGYRC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)SC(=N2)N)C(F)(F)F |
Computed by PubChem (NCBI)