CAS 68672-37-7 appears in our catalog under these names: ([4-Amino-3-(trifluoromethyl)phenyl]sulfanyl)formonitrile, 95%, {(4-Amino-3-(trifluoromethyl)phenyl)sulfanyl}formonitrile. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 250mg, 2,5g.
[4-amino-3-(trifluoromethyl)phenyl] thiocyanate (CAS 68672-37-7) is a chemical compound with the molecular formula C8H5F3N2S and a molecular weight of 218.20 g/mol. IUPAC name: [4-amino-3-(trifluoromethyl)phenyl] thiocyanate. InChIKey: AVAVGEJYYHSTIT-UHFFFAOYSA-N.
| Molecular formula | C8H5F3N2S |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | [4-amino-3-(trifluoromethyl)phenyl] thiocyanate |
| InChIKey | AVAVGEJYYHSTIT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1SC#N)C(F)(F)F)N |
Computed by PubChem (NCBI)