Products 60400-92-2
CAS 60400-92-2 is the registry number for Proxicromil. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-hydroxy-4-oxo-10-propyl-6,7,8,9-tetrahydrobenzo[g]chromene-2-carboxylic acid (CAS 60400-92-2) is a chemical compound with the molecular formula C17H18O5 and a molecular weight of 302.32 g/mol. IUPAC name: 5-hydroxy-4-oxo-10-propyl-6,7,8,9-tetrahydrobenzo[g]chromene-2-carboxylic acid. InChIKey: VFFTVZUIDYJUQS-UHFFFAOYSA-N.
| Molecular formula | C17H18O5 |
|---|---|
| Molecular weight | 302.32 g/mol |
| IUPAC name | 5-hydroxy-4-oxo-10-propyl-6,7,8,9-tetrahydrobenzo[g]chromene-2-carboxylic acid |
| InChIKey | VFFTVZUIDYJUQS-UHFFFAOYSA-N |
| SMILES | CCCC1=C2C(=C(C3=C1CCCC3)O)C(=O)C=C(O2)C(=O)O |
Computed by PubChem (NCBI)