CAS 60524-97-2 appears in our catalog under these names: Lansoprazole Impurity 15, Destrifluoroethoxy Lansoprazole. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(3-methyl-2-pyridinyl)methylsulfinyl]-1H-benzimidazole (CAS 60524-97-2) is a chemical compound with the molecular formula C14H13N3OS and a molecular weight of 271.34 g/mol. IUPAC name: 2-[(3-methyl-2-pyridinyl)methylsulfinyl]-1H-benzimidazole. InChIKey: MSVPDUIRKKWSDW-UHFFFAOYSA-N.
| Molecular formula | C14H13N3OS |
|---|---|
| Molecular weight | 271.34 g/mol |
| IUPAC name | 2-[(3-methyl-2-pyridinyl)methylsulfinyl]-1H-benzimidazole |
| InChIKey | MSVPDUIRKKWSDW-UHFFFAOYSA-N |
| SMILES | CC1=C(N=CC=C1)CS(=O)C2=NC3=CC=CC=C3N2 |
Computed by PubChem (NCBI)