CAS 606945-29-3 appears in our catalog under these names: 3-((4-(2-Chlorophenoxy)phenyl)sulfonamido)propanoic acid, 98%, 98%, 3-((4-(2-chlorophenoxy)phenyl)sulfonamido)propanoic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg.
3-[[4-(2-chlorophenoxy)phenyl]sulfonylamino]propanoic acid (CAS 606945-29-3) is a chemical compound with the molecular formula C15H14ClNO5S and a molecular weight of 355.8 g/mol. IUPAC name: 3-[[4-(2-chlorophenoxy)phenyl]sulfonylamino]propanoic acid. InChIKey: MNMHNWSFUSLJBT-UHFFFAOYSA-N.
| Molecular formula | C15H14ClNO5S |
|---|---|
| Molecular weight | 355.8 g/mol |
| IUPAC name | 3-[[4-(2-chlorophenoxy)phenyl]sulfonylamino]propanoic acid |
| InChIKey | MNMHNWSFUSLJBT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OC2=CC=C(C=C2)S(=O)(=O)NCCC(=O)O)Cl |
Computed by PubChem (NCBI)