CAS 794573-22-1 appears in our catalog under these names: 2-Chloro-5-((2-phenoxyethyl)sulfamoyl)benzoic acid, 95%, 2-Chloro-5-((2-phenoxyethyl)sulfamoyl)benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
2-chloro-5-(2-phenoxyethylsulfamoyl)benzoic acid (CAS 794573-22-1) is a chemical compound with the molecular formula C15H14ClNO5S and a molecular weight of 355.8 g/mol. IUPAC name: 2-chloro-5-(2-phenoxyethylsulfamoyl)benzoic acid. InChIKey: DGQKUOHWKOMZIA-UHFFFAOYSA-N.
| Molecular formula | C15H14ClNO5S |
|---|---|
| Molecular weight | 355.8 g/mol |
| IUPAC name | 2-chloro-5-(2-phenoxyethylsulfamoyl)benzoic acid |
| InChIKey | DGQKUOHWKOMZIA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OCCNS(=O)(=O)C2=CC(=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)