CAS 607-38-5 is the registry number for 8–Nitronaphthalen–2–amine. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
8-nitronaphthalen-2-amine (CAS 607-38-5) is a chemical compound with the molecular formula C10H8N2O2 and a molecular weight of 188.18 g/mol. IUPAC name: 8-nitronaphthalen-2-amine. InChIKey: FGLPIWSCAOGYBA-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O2 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 8-nitronaphthalen-2-amine |
| InChIKey | FGLPIWSCAOGYBA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=C2)N)C(=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)