Products 607723-54-6
CAS 607723-54-6 is the registry number for PYRIMIDINE, 4-CHLORO-6-(4-METHOXYPHENOXY)-, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-chloro-6-(4-methoxyphenoxy)pyrimidine (CAS 607723-54-6) is a chemical compound with the molecular formula C11H9ClN2O2 and a molecular weight of 236.65 g/mol. IUPAC name: 4-chloro-6-(4-methoxyphenoxy)pyrimidine. InChIKey: YERJZLPVPNPWLU-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN2O2 |
|---|---|
| Molecular weight | 236.65 g/mol |
| IUPAC name | 4-chloro-6-(4-methoxyphenoxy)pyrimidine |
| InChIKey | YERJZLPVPNPWLU-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)OC2=CC(=NC=N2)Cl |
Computed by PubChem (NCBI)