CAS 60812-53-5 appears in our catalog under these names: 5-Methoxy-3,3-dimethyl-2,3-dihydro-1h-inden-1-one, 95%, 5-Methoxy-3,3-dimethyl-2,3-dihydro-1H-inden-1-one, 97%, 5-Methoxy-3,3-dimethyl-2,3-dihydro-1H-inden-1-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
5-methoxy-3,3-dimethyl-2H-inden-1-one (CAS 60812-53-5) is a chemical compound with the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. IUPAC name: 5-methoxy-3,3-dimethyl-2H-inden-1-one. InChIKey: VQJNJGBSRXLRSA-UHFFFAOYSA-N.
| Molecular formula | C12H14O2 |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | 5-methoxy-3,3-dimethyl-2H-inden-1-one |
| InChIKey | VQJNJGBSRXLRSA-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)C2=C1C=C(C=C2)OC)C |
Computed by PubChem (NCBI)